2-(Cyanomethylthio)acetic acid
Catalog No: FT-0640341
CAS No: 55817-29-3
- Chemical Name: 2-(Cyanomethylthio)acetic acid
- Molecular Formula: C4H5NO2S
- Molecular Weight: 131.16
- InChI Key: JRRFRAHROZUYJH-UHFFFAOYSA-N
- InChI: InChI=1S/C4H5NO2S/c5-1-2-8-3-4(6)7/h2-3H2,(H,6,7)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 131.15300 |
| Density: | 1.358 |
| CAS: | 55817-29-3 |
| Bolling_Point: | 329ºC |
| Product_Name: | 2-(Cyanomethylthio)acetic Acid |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C4H5NO2S |
| Density: | 1.358 |
|---|---|
| LogP: | 0.32778 |
| Refractive_Index: | 1.535 |
| FW: | 131.15300 |
| PSA: | 86.39000 |
| MF: | C4H5NO2S |
| Bolling_Point: | 329ºC |
| Exact_Mass: | 131.00400 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2930909090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)